C17H12F5N3O2S2 — CID 19615173
2-(3-ethyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 19615173) has the molecular formula C17H12F5N3O2S2 and a molecular weight of 449.43 g/mol. Its IUPAC name is 2-(3-ethyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | 2-(3-ethyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 19615173 |
| Molecular Formula | C17H12F5N3O2S2 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 2-(3-ethyl-6-methyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2c(F)c(F)c(F)c(F)c2F)nc2sc(C)cc2c1=O |
| InChI | InChI=1S/C17H12F5N3O2S2/c1-3-25-16(27)7-4-6(2)29-15(7)24-17(25)28-5-8(26)23-14-12(21)10(19)9(18)11(20)13(14)22/h4H,3,5H2,1-2H3,(H,23,26) |
| InChIKey | ODQFBJORFVAXFS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|