C22H26N4O2S2 — CID 6491665
N-[4-(diethylamino)phenyl]-2-(6-methyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 6491665) has the molecular formula C22H26N4O2S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-(6-methyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-(6-methyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 6491665 |
| Molecular Formula | C22H26N4O2S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-(6-methyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(N(CC)CC)cc2)nc2sc(C)cc2c1=O |
| InChI | InChI=1S/C22H26N4O2S2/c1-5-12-26-21(28)18-13-15(4)30-20(18)24-22(26)29-14-19(27)23-16-8-10-17(11-9-16)25(6-2)7-3/h5,8-11,13H,1,6-7,12,14H2,2-4H3,(H,23,27) |
| InChIKey | PCBIADNGQHFNNC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|