C18H17ClFN3O7S — CID 19616439
(2-chloro-6-fluorophenyl)methyl 2-[[2-[(4-methyl-2-nitrophenyl)sulfonylamino]acetyl]amino]acetate (PubChem CID 19616439) has the molecular formula C18H17ClFN3O7S and a molecular weight of 473.87 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 2-[[2-[(4-methyl-2-nitrophenyl)sulfonylamino]acetyl]amino]acetate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 2-[[2-[(4-methyl-2-nitrophenyl)sulfonylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 19616439 |
| Molecular Formula | C18H17ClFN3O7S |
| Molecular Weight | 473.87 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 2-[[2-[(4-methyl-2-nitrophenyl)sulfonylamino]acetyl]amino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)NCC(=O)OCc2c(F)cccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17ClFN3O7S/c1-11-5-6-16(15(7-11)23(26)27)31(28,29)22-8-17(24)21-9-18(25)30-10-12-13(19)3-2-4-14(12)20/h2-7,22H,8-10H2,1H3,(H,21,24) |
| InChIKey | HIAOPAWUOOXVMU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|