C10H18ClN3 — CID 19619820
3-(4-chloro-3,5-dimethylpyrazol-1-yl)pentan-1-amine (PubChem CID 19619820) has the molecular formula C10H18ClN3 and a molecular weight of 215.73 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)pentan-1-amine.
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)pentan-1-amine |
|---|---|
| PubChem CID | 19619820 |
| Molecular Formula | C10H18ClN3 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)pentan-1-amine |
| SMILES | CCC(CCN)n1nc(C)c(Cl)c1C |
| InChI | InChI=1S/C10H18ClN3/c1-4-9(5-6-12)14-8(3)10(11)7(2)13-14/h9H,4-6,12H2,1-3H3 |
| InChIKey | VQGFWZZDKQWFAG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |