About 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol
1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol (PubChem CID 70566742) has the molecular formula C7H11ClN2O
and a molecular weight of 174.63 g/mol. Its IUPAC name is 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol |
| PubChem CID | 70566742 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol |
| SMILES | Cc1nn(C(C)O)c(C)c1Cl |
| InChI | InChI=1S/C7H11ClN2O/c1-4-7(8)5(2)10(9-4)6(3)11/h6,11H,1-3H3 |
| InChIKey | HCLACZGNKLEIBV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol?
The IUPAC name of 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol (CID 70566742) is 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol.
What is the SMILES notation for 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol?
The canonical SMILES for 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol is Cc1nn(C(C)O)c(C)c1Cl.
What is the InChIKey of 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol?
The InChIKey is HCLACZGNKLEIBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2O/c1-4-7(8)5(2)10(9-4)6(3)11/h6,11H,1-3H3.
What are the key properties of 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol?
1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol has a molecular weight of 174.63 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol is sourced from PubChem (CID 70566742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).