C7H11ClN2O — CID 70566742
1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol (PubChem CID 70566742) has the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. Its IUPAC name is 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol.
| Compound Name | 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol |
|---|---|
| PubChem CID | 70566742 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 1-(4-chloro-3,5-dimethylpyrazol-1-yl)ethanol |
| SMILES | Cc1nn(C(C)O)c(C)c1Cl |
| InChI | InChI=1S/C7H11ClN2O/c1-4-7(8)5(2)10(9-4)6(3)11/h6,11H,1-3H3 |
| InChIKey | HCLACZGNKLEIBV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |