C11H9N5O2 — CID 19620207
7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carbohydrazide (PubChem CID 19620207) has the molecular formula C11H9N5O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is 7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carbohydrazide.
| Compound Name | 7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carbohydrazide |
|---|---|
| PubChem CID | 19620207 |
| Molecular Formula | C11H9N5O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carbohydrazide |
| SMILES | NNC(=O)c1cnn2c(-c3ccco3)ccnc12 |
| InChI | InChI=1S/C11H9N5O2/c12-15-11(17)7-6-14-16-8(3-4-13-10(7)16)9-2-1-5-18-9/h1-6H,12H2,(H,15,17) |
| InChIKey | LXGPJZUFKYQBKS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|