C12H9ClO2S — CID 19621674
4-[(2-chlorophenoxy)methyl]thiophene-2-carbaldehyde (PubChem CID 19621674) has the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. Its IUPAC name is 4-[(2-chlorophenoxy)methyl]thiophene-2-carbaldehyde.
| Compound Name | 4-[(2-chlorophenoxy)methyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 19621674 |
| Molecular Formula | C12H9ClO2S |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 4-[(2-chlorophenoxy)methyl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1cc(COc2ccccc2Cl)cs1 |
| InChI | InChI=1S/C12H9ClO2S/c13-11-3-1-2-4-12(11)15-7-9-5-10(6-14)16-8-9/h1-6,8H,7H2 |
| InChIKey | BDXNUJRUJFGTML-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|