C17H18INO3 — CID 19628694
N-[3-(2-ethoxyethoxy)phenyl]-2-iodobenzamide (PubChem CID 19628694) has the molecular formula C17H18INO3 and a molecular weight of 411.24 g/mol. Its IUPAC name is N-[3-(2-ethoxyethoxy)phenyl]-2-iodobenzamide.
| Compound Name | N-[3-(2-ethoxyethoxy)phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 19628694 |
| Molecular Formula | C17H18INO3 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-[3-(2-ethoxyethoxy)phenyl]-2-iodobenzamide |
| SMILES | CCOCCOc1cccc(NC(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C17H18INO3/c1-2-21-10-11-22-14-7-5-6-13(12-14)19-17(20)15-8-3-4-9-16(15)18/h3-9,12H,2,10-11H2,1H3,(H,19,20) |
| InChIKey | OOGATKGIDVLAQO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|