C17H14FNO2S3 — CID 19629447
N-[4-[(2-fluorophenyl)methylsulfanyl]phenyl]thiophene-2-sulfonamide (PubChem CID 19629447) has the molecular formula C17H14FNO2S3 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[4-[(2-fluorophenyl)methylsulfanyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[(2-fluorophenyl)methylsulfanyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 19629447 |
| Molecular Formula | C17H14FNO2S3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | N-[4-[(2-fluorophenyl)methylsulfanyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(SCc2ccccc2F)cc1)c1cccs1 |
| InChI | InChI=1S/C17H14FNO2S3/c18-16-5-2-1-4-13(16)12-23-15-9-7-14(8-10-15)19-24(20,21)17-6-3-11-22-17/h1-11,19H,12H2 |
| InChIKey | YTIQESZVOSHYMD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |