C27H29N3OS — CID 19639287
3-(naphthalen-1-ylmethylsulfanyl)-5-[1-(4-propan-2-ylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19639287) has the molecular formula C27H29N3OS and a molecular weight of 443.62 g/mol. Its IUPAC name is 3-(naphthalen-1-ylmethylsulfanyl)-5-[1-(4-propan-2-ylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(naphthalen-1-ylmethylsulfanyl)-5-[1-(4-propan-2-ylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19639287 |
| Molecular Formula | C27H29N3OS |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 3-(naphthalen-1-ylmethylsulfanyl)-5-[1-(4-propan-2-ylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cccc3ccccc23)nnc1C(C)Oc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H29N3OS/c1-5-17-30-26(20(4)31-24-15-13-21(14-16-24)19(2)3)28-29-27(30)32-18-23-11-8-10-22-9-6-7-12-25(22)23/h5-16,19-20H,1,17-18H2,2-4H3 |
| InChIKey | FAQHNTALBCSLOI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|