C21H21Cl2N3O2S — CID 43883843
3-[(2,4-dichlorophenyl)methylsulfanyl]-5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 43883843) has the molecular formula C21H21Cl2N3O2S and a molecular weight of 450.39 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methylsulfanyl]-5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(2,4-dichlorophenyl)methylsulfanyl]-5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 43883843 |
| Molecular Formula | C21H21Cl2N3O2S |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methylsulfanyl]-5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccc(Cl)cc2Cl)nnc1C(C)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O2S/c1-4-11-26-20(14(2)28-18-9-7-17(27-3)8-10-18)24-25-21(26)29-13-15-5-6-16(22)12-19(15)23/h4-10,12,14H,1,11,13H2,2-3H3 |
| InChIKey | BMZZDQFNIFEXPZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|