C21H13Cl4NO3 — CID 19645200
3,4-dichloro-N-[4-[2-(2,4-dichlorophenyl)-2-oxoethoxy]phenyl]benzamide (PubChem CID 19645200) has the molecular formula C21H13Cl4NO3 and a molecular weight of 469.15 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[2-(2,4-dichlorophenyl)-2-oxoethoxy]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-[2-(2,4-dichlorophenyl)-2-oxoethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 19645200 |
| Molecular Formula | C21H13Cl4NO3 |
| Molecular Weight | 469.15 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | 3,4-dichloro-N-[4-[2-(2,4-dichlorophenyl)-2-oxoethoxy]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC(=O)c2ccc(Cl)cc2Cl)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H13Cl4NO3/c22-13-2-7-16(18(24)10-13)20(27)11-29-15-5-3-14(4-6-15)26-21(28)12-1-8-17(23)19(25)9-12/h1-10H,11H2,(H,26,28) |
| InChIKey | VUZUHNWSQPWWMT-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.15 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |