C12H24N2S — CID 19652429
1-(6-methylheptan-2-yl)-3-prop-2-enylthiourea (PubChem CID 19652429) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is 1-(6-methylheptan-2-yl)-3-prop-2-enylthiourea.
| Compound Name | 1-(6-methylheptan-2-yl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 19652429 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-(6-methylheptan-2-yl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NC(C)CCCC(C)C |
| InChI | InChI=1S/C12H24N2S/c1-5-9-13-12(15)14-11(4)8-6-7-10(2)3/h5,10-11H,1,6-9H2,2-4H3,(H2,13,14,15) |
| InChIKey | KJLZJAHTGDUYFM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|