C13H24N2S — CID 19652670
1-prop-2-enyl-3-(3,3,5-trimethylcyclohexyl)thiourea (PubChem CID 19652670) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(3,3,5-trimethylcyclohexyl)thiourea.
| Compound Name | 1-prop-2-enyl-3-(3,3,5-trimethylcyclohexyl)thiourea |
|---|---|
| PubChem CID | 19652670 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-prop-2-enyl-3-(3,3,5-trimethylcyclohexyl)thiourea |
| SMILES | C=CCNC(=S)NC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H24N2S/c1-5-6-14-12(16)15-11-7-10(2)8-13(3,4)9-11/h5,10-11H,1,6-9H2,2-4H3,(H2,14,15,16) |
| InChIKey | MLUKZNNXFUJKSE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|