C14H22N2O2S — CID 19652898
1-(3,5-dimethoxyphenyl)-3-pentan-3-ylthiourea (PubChem CID 19652898) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-pentan-3-ylthiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-pentan-3-ylthiourea |
|---|---|
| PubChem CID | 19652898 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-pentan-3-ylthiourea |
| SMILES | CCC(CC)NC(=S)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C14H22N2O2S/c1-5-10(6-2)15-14(19)16-11-7-12(17-3)9-13(8-11)18-4/h7-10H,5-6H2,1-4H3,(H2,15,16,19) |
| InChIKey | GNLDJIRSFBFWIQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|