C10H13N3O2S — CID 144617256
1-(3,5-dimethoxyphenyl)-3-(methylideneamino)thiourea (PubChem CID 144617256) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-(methylideneamino)thiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-(methylideneamino)thiourea |
|---|---|
| PubChem CID | 144617256 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-(methylideneamino)thiourea |
| SMILES | C=NNC(=S)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C10H13N3O2S/c1-11-13-10(16)12-7-4-8(14-2)6-9(5-7)15-3/h4-6H,1H2,2-3H3,(H2,12,13,16) |
| InChIKey | OQUTZECQKZQSRM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|