C26H22N4O8S — CID 19659576
methyl 2-[[2-[(2E)-2-[1-[4-(4-nitrobenzoyl)oxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19659576) has the molecular formula C26H22N4O8S and a molecular weight of 550.55 g/mol. Its IUPAC name is methyl 2-[[2-[(2E)-2-[1-[4-(4-nitrobenzoyl)oxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(2E)-2-[1-[4-(4-nitrobenzoyl)oxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19659576 |
| Molecular Formula | C26H22N4O8S |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | methyl 2-[[2-[(2E)-2-[1-[4-(4-nitrobenzoyl)oxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(=O)N/N=C(\C)c2ccc(OC(=O)c3ccc([N+](=O)[O-])cc3)cc2)sc2c1CCC2 |
| InChI | InChI=1S/C26H22N4O8S/c1-14(15-8-12-18(13-9-15)38-25(33)16-6-10-17(11-7-16)30(35)36)28-29-23(32)22(31)27-24-21(26(34)37-2)19-4-3-5-20(19)39-24/h6-13H,3-5H2,1-2H3,(H,27,31)(H,29,32)/b28-14+ |
| InChIKey | HJVBJBMOPYPULS-CCVNUDIWSA-N |
| XLogP | 3.63 |
| TPSA | 166.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|