C28H26N2O5 — CID 19666579
N-[4-[(4Z)-4-[[3-ethoxy-4-(2-phenylethoxy)phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide (PubChem CID 19666579) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[4-[(4Z)-4-[[3-ethoxy-4-(2-phenylethoxy)phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4Z)-4-[[3-ethoxy-4-(2-phenylethoxy)phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 19666579 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[4-[(4Z)-4-[[3-ethoxy-4-(2-phenylethoxy)phenyl]methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(NC(C)=O)cc3)OC2=O)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C28H26N2O5/c1-3-33-26-18-21(9-14-25(26)34-16-15-20-7-5-4-6-8-20)17-24-28(32)35-27(30-24)22-10-12-23(13-11-22)29-19(2)31/h4-14,17-18H,3,15-16H2,1-2H3,(H,29,31)/b24-17- |
| InChIKey | CFTOIXSANMGBRF-ULJHMMPZSA-N |
| XLogP | 5.01 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|