C21H17F3N2O4S2 — CID 19680277
methyl 2-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19680277) has the molecular formula C21H17F3N2O4S2 and a molecular weight of 482.51 g/mol. Its IUPAC name is methyl 2-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19680277 |
| Molecular Formula | C21H17F3N2O4S2 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | methyl 2-[[2-oxo-4-(trifluoromethyl)chromen-7-yl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccc3c(C(F)(F)F)cc(=O)oc3c2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H17F3N2O4S2/c1-29-19(28)17-12-4-2-3-5-15(12)32-18(17)26-20(31)25-10-6-7-11-13(21(22,23)24)9-16(27)30-14(11)8-10/h6-9H,2-5H2,1H3,(H2,25,26,31) |
| InChIKey | YTKRJCXWHXIZIO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|