C15H20N2O2S — CID 19683528
1-(4-butan-2-ylphenyl)sulfonyl-3,5-dimethylpyrazole (PubChem CID 19683528) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)sulfonyl-3,5-dimethylpyrazole.
| Compound Name | 1-(4-butan-2-ylphenyl)sulfonyl-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 19683528 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)sulfonyl-3,5-dimethylpyrazole |
| SMILES | CCC(C)c1ccc(S(=O)(=O)n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C15H20N2O2S/c1-5-11(2)14-6-8-15(9-7-14)20(18,19)17-13(4)10-12(3)16-17/h6-11H,5H2,1-4H3 |
| InChIKey | OWNBJJLHVZWYAA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |