C12H14N2O4S2 — CID 6459197
3,5-dimethyl-1-(3-methylsulfonylphenyl)sulfonylpyrazole (PubChem CID 6459197) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3,5-dimethyl-1-(3-methylsulfonylphenyl)sulfonylpyrazole.
| Compound Name | 3,5-dimethyl-1-(3-methylsulfonylphenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 6459197 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3,5-dimethyl-1-(3-methylsulfonylphenyl)sulfonylpyrazole |
| SMILES | Cc1cc(C)n(S(=O)(=O)c2cccc(S(C)(=O)=O)c2)n1 |
| InChI | InChI=1S/C12H14N2O4S2/c1-9-7-10(2)14(13-9)20(17,18)12-6-4-5-11(8-12)19(3,15)16/h4-8H,1-3H3 |
| InChIKey | IMWGIKAUZWLSHY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |