C11H13N3O2S — CID 19685769
2-[(2-cyanoacetyl)amino]-4-ethyl-5-methylthiophene-3-carboxamide (PubChem CID 19685769) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-[(2-cyanoacetyl)amino]-4-ethyl-5-methylthiophene-3-carboxamide.
| Compound Name | 2-[(2-cyanoacetyl)amino]-4-ethyl-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 19685769 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[(2-cyanoacetyl)amino]-4-ethyl-5-methylthiophene-3-carboxamide |
| SMILES | CCc1c(C)sc(NC(=O)CC#N)c1C(N)=O |
| InChI | InChI=1S/C11H13N3O2S/c1-3-7-6(2)17-11(9(7)10(13)16)14-8(15)4-5-12/h3-4H2,1-2H3,(H2,13,16)(H,14,15) |
| InChIKey | DBXQBEDXIZBAOR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |