C12H11F7N2O2S — CID 3459397
4-ethyl-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-methylthiophene-3-carboxamide (PubChem CID 3459397) has the molecular formula C12H11F7N2O2S and a molecular weight of 380.29 g/mol. Its IUPAC name is 4-ethyl-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-methylthiophene-3-carboxamide.
| Compound Name | 4-ethyl-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 3459397 |
| Molecular Formula | C12H11F7N2O2S |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 4-ethyl-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-methylthiophene-3-carboxamide |
| SMILES | CCc1c(C)sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1C(N)=O |
| InChI | InChI=1S/C12H11F7N2O2S/c1-3-5-4(2)24-8(6(5)7(20)22)21-9(23)10(13,14)11(15,16)12(17,18)19/h3H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | DYPYSVOIJGTMAW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|