C6H7N3O — CID 19690783
5,6-dihydrofuro[2,3-d]pyrimidin-2-amine (PubChem CID 19690783) has the molecular formula C6H7N3O and a molecular weight of 137.14 g/mol. Its IUPAC name is 5,6-dihydrofuro[2,3-d]pyrimidin-2-amine.
| Compound Name | 5,6-dihydrofuro[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 19690783 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 5,6-dihydrofuro[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1ncc2c(n1)OCC2 |
| InChI | InChI=1S/C6H7N3O/c7-6-8-3-4-1-2-10-5(4)9-6/h3H,1-2H2,(H2,7,8,9) |
| InChIKey | GKTQSMMWWKODFZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |