C7H8N2O2 — CID 57401300
2-methoxy-5,6-dihydrofuro[2,3-d]pyrimidine (PubChem CID 57401300) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-methoxy-5,6-dihydrofuro[2,3-d]pyrimidine.
| Compound Name | 2-methoxy-5,6-dihydrofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 57401300 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-methoxy-5,6-dihydrofuro[2,3-d]pyrimidine |
| SMILES | COc1ncc2c(n1)OCC2 |
| InChI | InChI=1S/C7H8N2O2/c1-10-7-8-4-5-2-3-11-6(5)9-7/h4H,2-3H2,1H3 |
| InChIKey | VUMDIBYEMCTYLB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |