C41H36N4S2 — CID 19693310
3-[4-[[4-(diphenylcarbamothioylamino)-3-methylphenyl]methyl]-2-methylphenyl]-1,1-diphenylthiourea (PubChem CID 19693310) has the molecular formula C41H36N4S2 and a molecular weight of 648.90 g/mol. Its IUPAC name is 3-[4-[[4-(diphenylcarbamothioylamino)-3-methylphenyl]methyl]-2-methylphenyl]-1,1-diphenylthiourea.
| Compound Name | 3-[4-[[4-(diphenylcarbamothioylamino)-3-methylphenyl]methyl]-2-methylphenyl]-1,1-diphenylthiourea |
|---|---|
| PubChem CID | 19693310 |
| Molecular Formula | C41H36N4S2 |
| Molecular Weight | 648.90 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | 3-[4-[[4-(diphenylcarbamothioylamino)-3-methylphenyl]methyl]-2-methylphenyl]-1,1-diphenylthiourea |
| SMILES | Cc1cc(Cc2ccc(NC(=S)N(c3ccccc3)c3ccccc3)c(C)c2)ccc1NC(=S)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H36N4S2/c1-30-27-32(23-25-38(30)42-40(46)44(34-15-7-3-8-16-34)35-17-9-4-10-18-35)29-33-24-26-39(31(2)28-33)43-41(47)45(36-19-11-5-12-20-36)37-21-13-6-14-22-37/h3-28H,29H2,1-2H3,(H,42,46)(H,43,47) |
| InChIKey | SCKFSCUHVNFFEO-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.90 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|