C20H16O8 — CID 19693482
3-(3,4-dicarboxyphenyl)-1-methyl-2,3-dihydro-1H-indene-4,5-dicarboxylic acid (PubChem CID 19693482) has the molecular formula C20H16O8 and a molecular weight of 384.34 g/mol. Its IUPAC name is 3-(3,4-dicarboxyphenyl)-1-methyl-2,3-dihydro-1H-indene-4,5-dicarboxylic acid.
| Compound Name | 3-(3,4-dicarboxyphenyl)-1-methyl-2,3-dihydro-1H-indene-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 19693482 |
| Molecular Formula | C20H16O8 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 3-(3,4-dicarboxyphenyl)-1-methyl-2,3-dihydro-1H-indene-4,5-dicarboxylic acid |
| SMILES | CC1CC(c2ccc(C(=O)O)c(C(=O)O)c2)c2c1ccc(C(=O)O)c2C(=O)O |
| InChI | InChI=1S/C20H16O8/c1-8-6-13(9-2-3-11(17(21)22)14(7-9)19(25)26)15-10(8)4-5-12(18(23)24)16(15)20(27)28/h2-5,7-8,13H,6H2,1H3,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | QPWBTLYTNOIFFC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |