C8H11N3O5S2 — CID 19693756
4-(dimethylaminocarbamoylsulfamoyl)thiophene-3-carboxylic acid (PubChem CID 19693756) has the molecular formula C8H11N3O5S2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 4-(dimethylaminocarbamoylsulfamoyl)thiophene-3-carboxylic acid.
| Compound Name | 4-(dimethylaminocarbamoylsulfamoyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 19693756 |
| Molecular Formula | C8H11N3O5S2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 4-(dimethylaminocarbamoylsulfamoyl)thiophene-3-carboxylic acid |
| SMILES | CN(C)NC(=O)NS(=O)(=O)c1cscc1C(=O)O |
| InChI | InChI=1S/C8H11N3O5S2/c1-11(2)9-8(14)10-18(15,16)6-4-17-3-5(6)7(12)13/h3-4H,1-2H3,(H,12,13)(H2,9,10,14) |
| InChIKey | SEDLSZLCQXKDHF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|