C20H25NO3 — CID 19694463
[1-benzyl-4-(2,4-dimethoxyphenyl)pyrrolidin-3-yl]methanol (PubChem CID 19694463) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is [1-benzyl-4-(2,4-dimethoxyphenyl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-benzyl-4-(2,4-dimethoxyphenyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 19694463 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [1-benzyl-4-(2,4-dimethoxyphenyl)pyrrolidin-3-yl]methanol |
| SMILES | COc1ccc(C2CN(Cc3ccccc3)CC2CO)c(OC)c1 |
| InChI | InChI=1S/C20H25NO3/c1-23-17-8-9-18(20(10-17)24-2)19-13-21(12-16(19)14-22)11-15-6-4-3-5-7-15/h3-10,16,19,22H,11-14H2,1-2H3 |
| InChIKey | KYIRMTPMGHQRQL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |