C20H22N2O — CID 67690165
2-[(3R,4R)-1-benzyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]acetonitrile (PubChem CID 67690165) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[(3R,4R)-1-benzyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]acetonitrile.
| Compound Name | 2-[(3R,4R)-1-benzyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 67690165 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-[(3R,4R)-1-benzyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]acetonitrile |
| SMILES | COc1ccccc1[C@@H]1CN(Cc2ccccc2)C[C@@H]1CC#N |
| InChI | InChI=1S/C20H22N2O/c1-23-20-10-6-5-9-18(20)19-15-22(14-17(19)11-12-21)13-16-7-3-2-4-8-16/h2-10,17,19H,11,13-15H2,1H3/t17-,19+/m0/s1 |
| InChIKey | ZKFMPKQOIWSAGG-PKOBYXMFSA-N |
| XLogP | 3.82 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |