C19H23NO2 — CID 67782895
[(3R,4R)-1-benzyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]methanol (PubChem CID 67782895) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is [(3R,4R)-1-benzyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]methanol.
| Compound Name | [(3R,4R)-1-benzyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 67782895 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [(3R,4R)-1-benzyl-4-(2-methoxyphenyl)pyrrolidin-3-yl]methanol |
| SMILES | COc1ccccc1[C@@H]1CN(Cc2ccccc2)C[C@@H]1CO |
| InChI | InChI=1S/C19H23NO2/c1-22-19-10-6-5-9-17(19)18-13-20(12-16(18)14-21)11-15-7-3-2-4-8-15/h2-10,16,18,21H,11-14H2,1H3/t16-,18-/m1/s1 |
| InChIKey | BEFLFSPFUVSYEB-SJLPKXTDSA-N |
| XLogP | 2.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |