C26H42FN — CID 19695177
4-[4-[4-[(E)-7-fluorohept-1-enyl]cyclohexyl]cyclohexyl]cyclohexane-1-carbonitrile (PubChem CID 19695177) has the molecular formula C26H42FN and a molecular weight of 387.63 g/mol. Its IUPAC name is 4-[4-[4-[(E)-7-fluorohept-1-enyl]cyclohexyl]cyclohexyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-[4-[(E)-7-fluorohept-1-enyl]cyclohexyl]cyclohexyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 19695177 |
| Molecular Formula | C26H42FN |
| Molecular Weight | 387.63 g/mol |
| Exact Mass | 387.33 |
| IUPAC Name | 4-[4-[4-[(E)-7-fluorohept-1-enyl]cyclohexyl]cyclohexyl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(C2CCC(C3CCC(/C=C/CCCCCF)CC3)CC2)CC1 |
| InChI | InChI=1S/C26H42FN/c27-19-5-3-1-2-4-6-21-7-11-23(12-8-21)25-15-17-26(18-16-25)24-13-9-22(20-28)10-14-24/h4,6,21-26H,1-3,5,7-19H2/b6-4+ |
| InChIKey | YIUIYUYUEUBXAV-GQCTYLIASA-N |
| XLogP | 8.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|