C23H36FN — CID 19695282
4-[4-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexyl]cyclohexane-1-carbonitrile (PubChem CID 19695282) has the molecular formula C23H36FN and a molecular weight of 345.55 g/mol. Its IUPAC name is 4-[4-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 19695282 |
| Molecular Formula | C23H36FN |
| Molecular Weight | 345.55 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | 4-[4-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexyl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(C2CCC(C3CCC(/C=C/CCF)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H36FN/c24-16-2-1-3-18-4-8-20(9-5-18)22-12-14-23(15-13-22)21-10-6-19(17-25)7-11-21/h1,3,18-23H,2,4-16H2/b3-1+ |
| InChIKey | ARNPAWYPBLSZFO-HNQUOIGGSA-N |
| XLogP | 6.84 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|