C19H14F3NO4 — CID 19696994
2-[1-benzoyl-5-methoxy-4-(trifluoromethyl)indol-3-yl]acetic acid (PubChem CID 19696994) has the molecular formula C19H14F3NO4 and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-[1-benzoyl-5-methoxy-4-(trifluoromethyl)indol-3-yl]acetic acid.
| Compound Name | 2-[1-benzoyl-5-methoxy-4-(trifluoromethyl)indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 19696994 |
| Molecular Formula | C19H14F3NO4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[1-benzoyl-5-methoxy-4-(trifluoromethyl)indol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c(CC(=O)O)cn2C(=O)c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO4/c1-27-14-8-7-13-16(17(14)19(20,21)22)12(9-15(24)25)10-23(13)18(26)11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,24,25) |
| InChIKey | OMNKMFYNZXSUEZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |