C22H16F3NO5 — CID 14621620
2-[benzoyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid (PubChem CID 14621620) has the molecular formula C22H16F3NO5 and a molecular weight of 431.37 g/mol. Its IUPAC name is 2-[benzoyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid.
| Compound Name | 2-[benzoyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 14621620 |
| Molecular Formula | C22H16F3NO5 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-[benzoyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid |
| SMILES | COc1ccc2c(C(=O)N(CC(=O)O)C(=O)c3ccccc3)cccc2c1C(F)(F)F |
| InChI | InChI=1S/C22H16F3NO5/c1-31-17-11-10-14-15(19(17)22(23,24)25)8-5-9-16(14)21(30)26(12-18(27)28)20(29)13-6-3-2-4-7-13/h2-11H,12H2,1H3,(H,27,28) |
| InChIKey | SANJKDJNMDFMPI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|