C17H14F3NO5 — CID 14621619
2-[acetyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid (PubChem CID 14621619) has the molecular formula C17H14F3NO5 and a molecular weight of 369.30 g/mol. Its IUPAC name is 2-[acetyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid.
| Compound Name | 2-[acetyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 14621619 |
| Molecular Formula | C17H14F3NO5 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-[acetyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid |
| SMILES | COc1ccc2c(C(=O)N(CC(=O)O)C(C)=O)cccc2c1C(F)(F)F |
| InChI | InChI=1S/C17H14F3NO5/c1-9(22)21(8-14(23)24)16(25)12-5-3-4-11-10(12)6-7-13(26-2)15(11)17(18,19)20/h3-7H,8H2,1-2H3,(H,23,24) |
| InChIKey | UOMHPGDWHPZLIW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |