C16H12F3NO5 — CID 14621618
2-[formyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid (PubChem CID 14621618) has the molecular formula C16H12F3NO5 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-[formyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid.
| Compound Name | 2-[formyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 14621618 |
| Molecular Formula | C16H12F3NO5 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-[formyl-[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbonyl]amino]acetic acid |
| SMILES | COc1ccc2c(C(=O)N(C=O)CC(=O)O)cccc2c1C(F)(F)F |
| InChI | InChI=1S/C16H12F3NO5/c1-25-12-6-5-9-10(14(12)16(17,18)19)3-2-4-11(9)15(24)20(8-21)7-13(22)23/h2-6,8H,7H2,1H3,(H,22,23) |
| InChIKey | YXOUXBPBANJWMR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|