About [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate
[2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate (PubChem CID 23056911) has the molecular formula C22H18F3NO5
and a molecular weight of 433.38 g/mol. Its IUPAC name is [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate |
| PubChem CID | 23056911 |
| Molecular Formula | C22H18F3NO5 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate |
| SMILES | CNCC(=O)OC(=O)c1c(Oc2ccccc2)ccc2c(C(F)(F)F)c(OC)ccc12 |
| InChI | InChI=1S/C22H18F3NO5/c1-26-12-18(27)31-21(28)19-14-8-11-17(29-2)20(22(23,24)25)15(14)9-10-16(19)30-13-6-4-3-5-7-13/h3-11,26H,12H2,1-2H3 |
| InChIKey | QDZDVKCXZSXIKJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate?
The IUPAC name of [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate (CID 23056911) is [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate.
What is the SMILES notation for [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate?
The canonical SMILES for [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate is CNCC(=O)OC(=O)c1c(Oc2ccccc2)ccc2c(C(F)(F)F)c(OC)ccc12.
What is the InChIKey of [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate?
The InChIKey is QDZDVKCXZSXIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F3NO5/c1-26-12-18(27)31-21(28)19-14-8-11-17(29-2)20(22(23,24)25)15(14)9-10-16(19)30-13-6-4-3-5-7-13/h3-11,26H,12H2,1-2H3.
What are the key properties of [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate?
[2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate has a molecular weight of 433.38 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)acetyl] 6-methoxy-2-phenoxy-5-(trifluoromethyl)naphthalene-1-carboxylate is sourced from PubChem (CID 23056911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).