C33H34O5 — CID 58608948
2,4-bis(2-methoxy-6-phenoxyphenyl)-2,4-dimethylpentan-3-one (PubChem CID 58608948) has the molecular formula C33H34O5 and a molecular weight of 510.63 g/mol. Its IUPAC name is 2,4-bis(2-methoxy-6-phenoxyphenyl)-2,4-dimethylpentan-3-one.
| Compound Name | 2,4-bis(2-methoxy-6-phenoxyphenyl)-2,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 58608948 |
| Molecular Formula | C33H34O5 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 2,4-bis(2-methoxy-6-phenoxyphenyl)-2,4-dimethylpentan-3-one |
| SMILES | COc1cccc(Oc2ccccc2)c1C(C)(C)C(=O)C(C)(C)c1c(OC)cccc1Oc1ccccc1 |
| InChI | InChI=1S/C33H34O5/c1-32(2,29-25(35-5)19-13-21-27(29)37-23-15-9-7-10-16-23)31(34)33(3,4)30-26(36-6)20-14-22-28(30)38-24-17-11-8-12-18-24/h7-22H,1-6H3 |
| InChIKey | HNUPZDUGSPHYMA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |