C36H32O7P+ — CID 70014463
benzoyl-(2,6-diphenoxyphenyl)-methyl-(2,4,6-trimethoxybenzoyl)phosphanium (PubChem CID 70014463) has the molecular formula C36H32O7P+ and a molecular weight of 607.62 g/mol. Its IUPAC name is benzoyl-(2,6-diphenoxyphenyl)-methyl-(2,4,6-trimethoxybenzoyl)phosphanium.
| Compound Name | benzoyl-(2,6-diphenoxyphenyl)-methyl-(2,4,6-trimethoxybenzoyl)phosphanium |
|---|---|
| PubChem CID | 70014463 |
| Molecular Formula | C36H32O7P+ |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | benzoyl-(2,6-diphenoxyphenyl)-methyl-(2,4,6-trimethoxybenzoyl)phosphanium |
| SMILES | COc1cc(OC)c(C(=O)[P+](C)(C(=O)c2ccccc2)c2c(Oc3ccccc3)cccc2Oc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C36H32O7P/c1-39-28-23-31(40-2)33(32(24-28)41-3)36(38)44(4,35(37)25-15-8-5-9-16-25)34-29(42-26-17-10-6-11-18-26)21-14-22-30(34)43-27-19-12-7-13-20-27/h5-24H,1-4H3/q+1 |
| InChIKey | GAHNFSXHTNZBNA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|