C20H16F3NO3 — CID 88607417
N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene (PubChem CID 88607417) has the molecular formula C20H16F3NO3 and a molecular weight of 375.35 g/mol. Its IUPAC name is N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene.
| Compound Name | N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 88607417 |
| Molecular Formula | C20H16F3NO3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene |
| SMILES | COc1ccc2ccccc2c1C(F)(F)F.O=CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H9F3O.C8H7NO2/c1-16-10-7-6-8-4-2-3-5-9(8)11(10)12(13,14)15;10-6-9-8(11)7-4-2-1-3-5-7/h2-7H,1H3;1-6H,(H,9,10,11) |
| InChIKey | ZLMVOIFTITXNLM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|