About N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene
N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene (PubChem CID 88607417) has the molecular formula C20H16F3NO3
and a molecular weight of 375.35 g/mol. Its IUPAC name is N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene.
Molecular Properties
| Compound Name | N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene |
| PubChem CID | 88607417 |
| Molecular Formula | C20H16F3NO3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene |
| SMILES | COc1ccc2ccccc2c1C(F)(F)F.O=CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H9F3O.C8H7NO2/c1-16-10-7-6-8-4-2-3-5-9(8)11(10)12(13,14)15;10-6-9-8(11)7-4-2-1-3-5-7/h2-7H,1H3;1-6H,(H,9,10,11) |
| InChIKey | ZLMVOIFTITXNLM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene?
The IUPAC name of N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene (CID 88607417) is N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene.
What is the SMILES notation for N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene?
The canonical SMILES for N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene is COc1ccc2ccccc2c1C(F)(F)F.O=CNC(=O)c1ccccc1.
What is the InChIKey of N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene?
The InChIKey is ZLMVOIFTITXNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3O.C8H7NO2/c1-16-10-7-6-8-4-2-3-5-9(8)11(10)12(13,14)15;10-6-9-8(11)7-4-2-1-3-5-7/h2-7H,1H3;1-6H,(H,9,10,11).
What are the key properties of N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene?
N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene has a molecular weight of 375.35 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-formylbenzamide;2-methoxy-1-(trifluoromethyl)naphthalene is sourced from PubChem (CID 88607417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).