C16H16N2O5 — CID 14907783
[1,3-diamino-2-(2-methoxynaphthalen-1-yl)-1,3-dioxopropan-2-yl] acetate (PubChem CID 14907783) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is [1,3-diamino-2-(2-methoxynaphthalen-1-yl)-1,3-dioxopropan-2-yl] acetate.
| Compound Name | [1,3-diamino-2-(2-methoxynaphthalen-1-yl)-1,3-dioxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 14907783 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [1,3-diamino-2-(2-methoxynaphthalen-1-yl)-1,3-dioxopropan-2-yl] acetate |
| SMILES | COc1ccc2ccccc2c1C(OC(C)=O)(C(N)=O)C(N)=O |
| InChI | InChI=1S/C16H16N2O5/c1-9(19)23-16(14(17)20,15(18)21)13-11-6-4-3-5-10(11)7-8-12(13)22-2/h3-8H,1-2H3,(H2,17,20)(H2,18,21) |
| InChIKey | KFYCWNSUXZGADU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|