methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate

C13H10F5NO4 — CID 569393

IUPACmethyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate
SMILESCOC(=O)CN(C(=O)c1ccccc1)C(=O)C(F)(F)C(F)(F)F
InChIInChI=1S/C13H10F5NO4/c1-23-9(20)7-19(10(21)8-5-3-2-4-6-8)11(22)12(14,15)13(16,17)18/h2-6H,7H2,1H3
InChIKeyPPYCZFPFMJSCCV-UHFFFAOYSA-N
MW339.22 g/mol
LogP2.03
Rot. Bonds4

About methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate

methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate (PubChem CID 569393) has the molecular formula C13H10F5NO4 and a molecular weight of 339.22 g/mol. Its IUPAC name is methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate
PubChem CID569393
Molecular FormulaC13H10F5NO4
Molecular Weight339.22 g/mol
Exact Mass339.05
IUPAC Namemethyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate
SMILESCOC(=O)CN(C(=O)c1ccccc1)C(=O)C(F)(F)C(F)(F)F
InChIInChI=1S/C13H10F5NO4/c1-23-9(20)7-19(10(21)8-5-3-2-4-6-8)11(22)12(14,15)13(16,17)18/h2-6H,7H2,1H3
InChIKeyPPYCZFPFMJSCCV-UHFFFAOYSA-N
XLogP2.03
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.22
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate?
The IUPAC name of methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate (CID 569393) is methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate.
What is the SMILES notation for methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate?
The canonical SMILES for methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate is COC(=O)CN(C(=O)c1ccccc1)C(=O)C(F)(F)C(F)(F)F.
What is the InChIKey of methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate?
The InChIKey is PPYCZFPFMJSCCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F5NO4/c1-23-9(20)7-19(10(21)8-5-3-2-4-6-8)11(22)12(14,15)13(16,17)18/h2-6H,7H2,1H3.
What are the key properties of methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate?
methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate has a molecular weight of 339.22 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate is sourced from PubChem (CID 569393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).