C13H10F5NO4 — CID 569393
methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate (PubChem CID 569393) has the molecular formula C13H10F5NO4 and a molecular weight of 339.22 g/mol. Its IUPAC name is methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate.
| Compound Name | methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate |
|---|---|
| PubChem CID | 569393 |
| Molecular Formula | C13H10F5NO4 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | methyl 2-[benzoyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate |
| SMILES | COC(=O)CN(C(=O)c1ccccc1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F5NO4/c1-23-9(20)7-19(10(21)8-5-3-2-4-6-8)11(22)12(14,15)13(16,17)18/h2-6H,7H2,1H3 |
| InChIKey | PPYCZFPFMJSCCV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|