C26H38NO5P — CID 19699942
ethyl 5-[(3-benzylphenyl)methyl-methylamino]-2-diethoxyphosphorylpentanoate (PubChem CID 19699942) has the molecular formula C26H38NO5P and a molecular weight of 475.57 g/mol. Its IUPAC name is ethyl 5-[(3-benzylphenyl)methyl-methylamino]-2-diethoxyphosphorylpentanoate.
| Compound Name | ethyl 5-[(3-benzylphenyl)methyl-methylamino]-2-diethoxyphosphorylpentanoate |
|---|---|
| PubChem CID | 19699942 |
| Molecular Formula | C26H38NO5P |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | ethyl 5-[(3-benzylphenyl)methyl-methylamino]-2-diethoxyphosphorylpentanoate |
| SMILES | CCOC(=O)C(CCCN(C)Cc1cccc(Cc2ccccc2)c1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C26H38NO5P/c1-5-30-26(28)25(33(29,31-6-2)32-7-3)17-12-18-27(4)21-24-16-11-15-23(20-24)19-22-13-9-8-10-14-22/h8-11,13-16,20,25H,5-7,12,17-19,21H2,1-4H3 |
| InChIKey | AUPIQONHRNMECL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|