C22H28NO5P — CID 10740675
methyl 4-[(3S,5R)-4-benzyl-2-methoxy-2-oxo-5-phenyl-1,4,2λ5-oxazaphosphinan-3-yl]butanoate (PubChem CID 10740675) has the molecular formula C22H28NO5P and a molecular weight of 417.44 g/mol. Its IUPAC name is methyl 4-[(3S,5R)-4-benzyl-2-methoxy-2-oxo-5-phenyl-1,4,2λ5-oxazaphosphinan-3-yl]butanoate.
| Compound Name | methyl 4-[(3S,5R)-4-benzyl-2-methoxy-2-oxo-5-phenyl-1,4,2λ5-oxazaphosphinan-3-yl]butanoate |
|---|---|
| PubChem CID | 10740675 |
| Molecular Formula | C22H28NO5P |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | methyl 4-[(3S,5R)-4-benzyl-2-methoxy-2-oxo-5-phenyl-1,4,2λ5-oxazaphosphinan-3-yl]butanoate |
| SMILES | COC(=O)CCC[C@H]1N(Cc2ccccc2)[C@H](c2ccccc2)COP1(=O)OC |
| InChI | InChI=1S/C22H28NO5P/c1-26-22(24)15-9-14-21-23(16-18-10-5-3-6-11-18)20(17-28-29(21,25)27-2)19-12-7-4-8-13-19/h3-8,10-13,20-21H,9,14-17H2,1-2H3/t20-,21-,29?/m0/s1 |
| InChIKey | MWNQTCNLZRQDFM-RLTOAWKYSA-N |
| XLogP | 4.77 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|