C21H26NO5P — CID 10525208
methyl 4-[(3S,5R)-4-benzyl-2-hydroxy-2-oxo-5-phenyl-1,4,2λ5-oxazaphosphinan-3-yl]butanoate (PubChem CID 10525208) has the molecular formula C21H26NO5P and a molecular weight of 403.42 g/mol. Its IUPAC name is methyl 4-[(3S,5R)-4-benzyl-2-hydroxy-2-oxo-5-phenyl-1,4,2λ5-oxazaphosphinan-3-yl]butanoate.
| Compound Name | methyl 4-[(3S,5R)-4-benzyl-2-hydroxy-2-oxo-5-phenyl-1,4,2λ5-oxazaphosphinan-3-yl]butanoate |
|---|---|
| PubChem CID | 10525208 |
| Molecular Formula | C21H26NO5P |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | methyl 4-[(3S,5R)-4-benzyl-2-hydroxy-2-oxo-5-phenyl-1,4,2λ5-oxazaphosphinan-3-yl]butanoate |
| SMILES | COC(=O)CCC[C@H]1N(Cc2ccccc2)[C@H](c2ccccc2)COP1(=O)O |
| InChI | InChI=1S/C21H26NO5P/c1-26-21(23)14-8-13-20-22(15-17-9-4-2-5-10-17)19(16-27-28(20,24)25)18-11-6-3-7-12-18/h2-7,9-12,19-20H,8,13-16H2,1H3,(H,24,25)/t19-,20-/m0/s1 |
| InChIKey | BPCJORMADOBOAG-PMACEKPBSA-N |
| XLogP | 4.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|