C24H26NO3P — CID 10573442
(3S,5R)-3,4-dibenzyl-2-methoxy-5-phenyl-1,4,2lambda5-oxazaphosphinane 2-oxide (PubChem CID 10573442) has the molecular formula C24H26NO3P and a molecular weight of 407.45 g/mol. Its IUPAC name is (3S,5R)-3,4-dibenzyl-2-methoxy-5-phenyl-1,4,2lambda5-oxazaphosphinane 2-oxide.
| Compound Name | (3S,5R)-3,4-dibenzyl-2-methoxy-5-phenyl-1,4,2lambda5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 10573442 |
| Molecular Formula | C24H26NO3P |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (3S,5R)-3,4-dibenzyl-2-methoxy-5-phenyl-1,4,2lambda5-oxazaphosphinane 2-oxide |
| SMILES | COP1(=O)OC[C@@H](c2ccccc2)N(Cc2ccccc2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H26NO3P/c1-27-29(26)24(17-20-11-5-2-6-12-20)25(18-21-13-7-3-8-14-21)23(19-28-29)22-15-9-4-10-16-22/h2-16,23-24H,17-19H2,1H3/t23-,24-,29?/m0/s1 |
| InChIKey | LUPGMIKAYFLPMO-AOHZEJALSA-N |
| XLogP | 5.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|