C19H22NO4P — CID 10237094
ethyl 2-(2-oxo-2,4-diphenyl-1,3,2λ5-oxazaphosphinan-3-yl)acetate (PubChem CID 10237094) has the molecular formula C19H22NO4P and a molecular weight of 359.36 g/mol. Its IUPAC name is ethyl 2-(2-oxo-2,4-diphenyl-1,3,2λ5-oxazaphosphinan-3-yl)acetate.
| Compound Name | ethyl 2-(2-oxo-2,4-diphenyl-1,3,2λ5-oxazaphosphinan-3-yl)acetate |
|---|---|
| PubChem CID | 10237094 |
| Molecular Formula | C19H22NO4P |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | ethyl 2-(2-oxo-2,4-diphenyl-1,3,2λ5-oxazaphosphinan-3-yl)acetate |
| SMILES | CCOC(=O)CN1C(c2ccccc2)CCOP1(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22NO4P/c1-2-23-19(21)15-20-18(16-9-5-3-6-10-16)13-14-24-25(20,22)17-11-7-4-8-12-17/h3-12,18H,2,13-15H2,1H3 |
| InChIKey | LUHOPVXNRMGRQT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|