C19H13ClN4O2 — CID 19700967
5-(3-chlorophenyl)-7-[(1-oxidopyridin-1-ium-4-yl)methyl]pyrido[2,3-d]pyridazin-8-one (PubChem CID 19700967) has the molecular formula C19H13ClN4O2 and a molecular weight of 364.79 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-7-[(1-oxidopyridin-1-ium-4-yl)methyl]pyrido[2,3-d]pyridazin-8-one.
| Compound Name | 5-(3-chlorophenyl)-7-[(1-oxidopyridin-1-ium-4-yl)methyl]pyrido[2,3-d]pyridazin-8-one |
|---|---|
| PubChem CID | 19700967 |
| Molecular Formula | C19H13ClN4O2 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 5-(3-chlorophenyl)-7-[(1-oxidopyridin-1-ium-4-yl)methyl]pyrido[2,3-d]pyridazin-8-one |
| SMILES | O=c1c2ncccc2c(-c2cccc(Cl)c2)nn1Cc1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C19H13ClN4O2/c20-15-4-1-3-14(11-15)17-16-5-2-8-21-18(16)19(25)24(22-17)12-13-6-9-23(26)10-7-13/h1-11H,12H2 |
| InChIKey | OAXKLGFOVNFFHG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|