C21H17N3O2 — CID 67836611
7-benzyl-5-(2-methoxyphenyl)pyrido[2,3-d]pyridazin-8-one (PubChem CID 67836611) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 7-benzyl-5-(2-methoxyphenyl)pyrido[2,3-d]pyridazin-8-one.
| Compound Name | 7-benzyl-5-(2-methoxyphenyl)pyrido[2,3-d]pyridazin-8-one |
|---|---|
| PubChem CID | 67836611 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 7-benzyl-5-(2-methoxyphenyl)pyrido[2,3-d]pyridazin-8-one |
| SMILES | COc1ccccc1-c1nn(Cc2ccccc2)c(=O)c2ncccc12 |
| InChI | InChI=1S/C21H17N3O2/c1-26-18-12-6-5-10-16(18)19-17-11-7-13-22-20(17)21(25)24(23-19)14-15-8-3-2-4-9-15/h2-13H,14H2,1H3 |
| InChIKey | RJMMYJKLAJNCOU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |